C14H19N3O — CID 3760504
1-(5-amino-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)pyrrolidin-2-one (PubChem CID 3760504) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 1-(5-amino-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)pyrrolidin-2-one.
| Compound Name | 1-(5-amino-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 3760504 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-(5-amino-2-methyl-1,2,3,4-tetrahydroquinolin-4-yl)pyrrolidin-2-one |
| SMILES | CC1CC(N2CCCC2=O)c2c(N)cccc2N1 |
| InChI | InChI=1S/C14H19N3O/c1-9-8-12(17-7-3-6-13(17)18)14-10(15)4-2-5-11(14)16-9/h2,4-5,9,12,16H,3,6-8,15H2,1H3 |
| InChIKey | TZWOYVQTRTVIIE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|