C21H28N2OS — CID 143069958
1-[6-tert-butyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one (PubChem CID 143069958) has the molecular formula C21H28N2OS and a molecular weight of 356.54 g/mol. Its IUPAC name is 1-[6-tert-butyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[6-tert-butyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143069958 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-[6-tert-butyl-2-[(1E)-1-sulfanylbuta-1,3-dien-2-yl]-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
| SMILES | C=C/C(=C\S)C1CC(N2CCCC2=O)c2cc(C(C)(C)C)ccc2N1 |
| InChI | InChI=1S/C21H28N2OS/c1-5-14(13-25)18-12-19(23-10-6-7-20(23)24)16-11-15(21(2,3)4)8-9-17(16)22-18/h5,8-9,11,13,18-19,22,25H,1,6-7,10,12H2,2-4H3/b14-13+ |
| InChIKey | IAJJABOMNDQFHL-BUHFOSPRSA-N |
| XLogP | 4.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|