C25H22ClN4O2S+ — CID 3766303
4-chloro-N-[3-(4-cyclohex-3-en-1-ylpyridin-1-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 3766303) has the molecular formula C25H22ClN4O2S+ and a molecular weight of 478.00 g/mol. Its IUPAC name is 4-chloro-N-[3-(4-cyclohex-3-en-1-ylpyridin-1-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(4-cyclohex-3-en-1-ylpyridin-1-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3766303 |
| Molecular Formula | C25H22ClN4O2S+ |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 4-chloro-N-[3-(4-cyclohex-3-en-1-ylpyridin-1-ium-1-yl)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1-[n+]1ccc(C2CC=CCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClN4O2S/c26-20-10-12-21(13-11-20)33(31,32)29-24-25(28-23-9-5-4-8-22(23)27-24)30-16-14-19(15-17-30)18-6-2-1-3-7-18/h1-2,4-5,8-18H,3,6-7H2,(H,27,29)/q+1 |
| InChIKey | IYKRBHPTRHNISH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|