C15H16ClN3O3 — CID 3766642
2-[(4-amino-2-hydroxyanilino)methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 3766642) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-[(4-amino-2-hydroxyanilino)methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[(4-amino-2-hydroxyanilino)methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 3766642 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-[(4-amino-2-hydroxyanilino)methyl]-5-chloro-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Nc1ccc(NCN2C(=O)C3CC=C(Cl)CC3C2=O)c(O)c1 |
| InChI | InChI=1S/C15H16ClN3O3/c16-8-1-3-10-11(5-8)15(22)19(14(10)21)7-18-12-4-2-9(17)6-13(12)20/h1-2,4,6,10-11,18,20H,3,5,7,17H2 |
| InChIKey | PHWDNIUYVWULSB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|