C27H30O12 — CID 3779153
[3,4,5-triacetyloxy-6-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]oxan-2-yl]methyl acetate (PubChem CID 3779153) has the molecular formula C27H30O12 and a molecular weight of 546.53 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3779153 |
| Molecular Formula | C27H30O12 |
| Molecular Weight | 546.53 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[(7-methyl-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-9-yl)oxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2cc(C)cc3oc(=O)c4c(c23)CCC4)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C27H30O12/c1-12-9-19-22(17-7-6-8-18(17)26(32)37-19)20(10-12)38-27-25(36-16(5)31)24(35-15(4)30)23(34-14(3)29)21(39-27)11-33-13(2)28/h9-10,21,23-25,27H,6-8,11H2,1-5H3 |
| InChIKey | BRCZNBQDTXWHFH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 153.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|