C19H15BrN4O4 — CID 3806365
5-(5-bromofuran-2-yl)-3-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]-1,3,4-oxadiazol-2-one (PubChem CID 3806365) has the molecular formula C19H15BrN4O4 and a molecular weight of 443.26 g/mol. Its IUPAC name is 5-(5-bromofuran-2-yl)-3-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(5-bromofuran-2-yl)-3-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 3806365 |
| Molecular Formula | C19H15BrN4O4 |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 5-(5-bromofuran-2-yl)-3-[2-oxo-2-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethyl]-1,3,4-oxadiazol-2-one |
| SMILES | O=C(Cn1nc(-c2ccc(Br)o2)oc1=O)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C19H15BrN4O4/c20-16-6-5-15(27-16)18-22-24(19(26)28-18)10-17(25)23-8-7-12-11-3-1-2-4-13(11)21-14(12)9-23/h1-6,21H,7-10H2 |
| InChIKey | WZAOGDHNRTUCGR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|