C17H24N2O3 — CID 3814351
3-(4-tert-butyl-2,5-diethoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 3814351) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(4-tert-butyl-2,5-diethoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(4-tert-butyl-2,5-diethoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 3814351 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-(4-tert-butyl-2,5-diethoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | CCOc1cc(C(C)(C)C)c(OCC)cc1-c1cc(N)on1 |
| InChI | InChI=1S/C17H24N2O3/c1-6-20-14-9-12(17(3,4)5)15(21-7-2)8-11(14)13-10-16(18)22-19-13/h8-10H,6-7,18H2,1-5H3 |
| InChIKey | LTGBKXVSEDBNAI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |