C23H31ClN4O3 — CID 38154641
1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclopentyloxypropyl)piperidine-4-carboxamide (PubChem CID 38154641) has the molecular formula C23H31ClN4O3 and a molecular weight of 446.98 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclopentyloxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclopentyloxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38154641 |
| Molecular Formula | C23H31ClN4O3 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclopentyloxypropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCOC1CCCC1)C1CCN(Cc2nc(-c3ccccc3Cl)no2)CC1 |
| InChI | InChI=1S/C23H31ClN4O3/c24-20-9-4-3-8-19(20)22-26-21(31-27-22)16-28-13-10-17(11-14-28)23(29)25-12-5-15-30-18-6-1-2-7-18/h3-4,8-9,17-18H,1-2,5-7,10-16H2,(H,25,29) |
| InChIKey | XPOLHPRVUYUDDL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|