C25H19N5OS — CID 38283647
(E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 38283647) has the molecular formula C25H19N5OS and a molecular weight of 437.53 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 38283647 |
| Molecular Formula | C25H19N5OS |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C25H19N5OS/c31-23(27-16-24-28-21-10-4-5-11-22(21)32-24)13-12-19-17-30(20-8-2-1-3-9-20)29-25(19)18-7-6-14-26-15-18/h1-15,17H,16H2,(H,27,31)/b13-12+ |
| InChIKey | ABMYVBRRVCIVGE-OUKQBFOZSA-N |
| XLogP | 4.87 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|