C23H32O6 — CID 38353221
[(1S,2R,5S,7R,10S,14S)-2,6,6,10,14-pentamethyl-3,16-dioxo-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadec-12(17)-en-5-yl] acetate (PubChem CID 38353221) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is [(1S,2R,5S,7R,10S,14S)-2,6,6,10,14-pentamethyl-3,16-dioxo-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadec-12(17)-en-5-yl] acetate.
| Compound Name | [(1S,2R,5S,7R,10S,14S)-2,6,6,10,14-pentamethyl-3,16-dioxo-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadec-12(17)-en-5-yl] acetate |
|---|---|
| PubChem CID | 38353221 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [(1S,2R,5S,7R,10S,14S)-2,6,6,10,14-pentamethyl-3,16-dioxo-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadec-12(17)-en-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)[C@]2(C)[C@H](CC[C@]3(C)OC4=C(C[C@@H]23)C(=O)C[C@H](C)O4)C1(C)C |
| InChI | InChI=1S/C23H32O6/c1-12-9-15(25)14-10-17-22(5,29-20(14)27-12)8-7-16-21(3,4)19(28-13(2)24)11-18(26)23(16,17)6/h12,16-17,19H,7-11H2,1-6H3/t12-,16+,17+,19-,22-,23+/m0/s1 |
| InChIKey | RGLPHKBIBOUYQQ-VAUXVZCYSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |