C21H28O5 — CID 125416451
(1R,2S,7R,10R,14R)-4-hydroxy-2,6,6,10,14-pentamethyl-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-4,12(17)-diene-3,16-dione (PubChem CID 125416451) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (1R,2S,7R,10R,14R)-4-hydroxy-2,6,6,10,14-pentamethyl-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-4,12(17)-diene-3,16-dione.
| Compound Name | (1R,2S,7R,10R,14R)-4-hydroxy-2,6,6,10,14-pentamethyl-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-4,12(17)-diene-3,16-dione |
|---|---|
| PubChem CID | 125416451 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (1R,2S,7R,10R,14R)-4-hydroxy-2,6,6,10,14-pentamethyl-11,13-dioxatetracyclo[8.8.0.02,7.012,17]octadeca-4,12(17)-diene-3,16-dione |
| SMILES | C[C@@H]1CC(=O)C2=C(O1)O[C@]1(C)CC[C@@H]3C(C)(C)C=C(O)C(=O)[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C21H28O5/c1-11-8-13(22)12-9-16-20(4,26-18(12)25-11)7-6-15-19(2,3)10-14(23)17(24)21(15,16)5/h10-11,15-16,23H,6-9H2,1-5H3/t11-,15-,16+,20-,21+/m1/s1 |
| InChIKey | ORKFUAJHKSRPFC-PQHSHHISSA-N |
| XLogP | 3.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |