C21H28O6 — CID 125416548
(1S,2S,4S,6S,7R,8R,11R,15R)-7-(hydroxymethyl)-2,7,11,15-tetramethyl-5,12,14-trioxapentacyclo[9.8.0.02,8.04,6.013,18]nonadec-13(18)-ene-3,17-dione (PubChem CID 125416548) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (1S,2S,4S,6S,7R,8R,11R,15R)-7-(hydroxymethyl)-2,7,11,15-tetramethyl-5,12,14-trioxapentacyclo[9.8.0.02,8.04,6.013,18]nonadec-13(18)-ene-3,17-dione.
| Compound Name | (1S,2S,4S,6S,7R,8R,11R,15R)-7-(hydroxymethyl)-2,7,11,15-tetramethyl-5,12,14-trioxapentacyclo[9.8.0.02,8.04,6.013,18]nonadec-13(18)-ene-3,17-dione |
|---|---|
| PubChem CID | 125416548 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1S,2S,4S,6S,7R,8R,11R,15R)-7-(hydroxymethyl)-2,7,11,15-tetramethyl-5,12,14-trioxapentacyclo[9.8.0.02,8.04,6.013,18]nonadec-13(18)-ene-3,17-dione |
| SMILES | C[C@@H]1CC(=O)C2=C(O1)O[C@]1(C)CC[C@@H]3[C@](C)(CO)[C@@H]4O[C@@H]4C(=O)[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C21H28O6/c1-10-7-12(23)11-8-14-20(3,27-18(11)25-10)6-5-13-19(2,9-22)17-15(26-17)16(24)21(13,14)4/h10,13-15,17,22H,5-9H2,1-4H3/t10-,13-,14-,15-,17-,19+,20-,21+/m1/s1 |
| InChIKey | WQOKQNWHPRUKFG-LZTZFZGCSA-N |
| XLogP | 2.14 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|