C16H25ClO5 — CID 38360321
(1S,2S,4S,6S,10S,11S)-10-chloro-6-[(2R)-2-hydroxypentyl]-9,9-dimethyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one (PubChem CID 38360321) has the molecular formula C16H25ClO5 and a molecular weight of 332.82 g/mol. Its IUPAC name is (1S,2S,4S,6S,10S,11S)-10-chloro-6-[(2R)-2-hydroxypentyl]-9,9-dimethyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one.
| Compound Name | (1S,2S,4S,6S,10S,11S)-10-chloro-6-[(2R)-2-hydroxypentyl]-9,9-dimethyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one |
|---|---|
| PubChem CID | 38360321 |
| Molecular Formula | C16H25ClO5 |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (1S,2S,4S,6S,10S,11S)-10-chloro-6-[(2R)-2-hydroxypentyl]-9,9-dimethyl-3,7,12-trioxatricyclo[9.1.0.02,4]dodecan-8-one |
| SMILES | CCC[C@@H](O)C[C@H]1C[C@@H]2O[C@@H]2[C@@H]2O[C@@H]2[C@@H](Cl)C(C)(C)C(=O)O1 |
| InChI | InChI=1S/C16H25ClO5/c1-4-5-8(18)6-9-7-10-11(21-10)12-13(22-12)14(17)16(2,3)15(19)20-9/h8-14,18H,4-7H2,1-3H3/t8-,9+,10+,11+,12+,13+,14-/m1/s1 |
| InChIKey | XIDNFNLBSAQIMG-GYVIJWDYSA-N |
| XLogP | 2.02 |
| TPSA | 71.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|