C16H28O6 — CID 95225010
(2R,4S,5E,7S,8R)-4,7,8-trihydroxy-2-[(2S)-2-hydroxypentyl]-9,9-dimethyl-3,4,7,8-tetrahydro-2H-oxecin-10-one (PubChem CID 95225010) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is (2R,4S,5E,7S,8R)-4,7,8-trihydroxy-2-[(2S)-2-hydroxypentyl]-9,9-dimethyl-3,4,7,8-tetrahydro-2H-oxecin-10-one.
| Compound Name | (2R,4S,5E,7S,8R)-4,7,8-trihydroxy-2-[(2S)-2-hydroxypentyl]-9,9-dimethyl-3,4,7,8-tetrahydro-2H-oxecin-10-one |
|---|---|
| PubChem CID | 95225010 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2R,4S,5E,7S,8R)-4,7,8-trihydroxy-2-[(2S)-2-hydroxypentyl]-9,9-dimethyl-3,4,7,8-tetrahydro-2H-oxecin-10-one |
| SMILES | CCC[C@H](O)C[C@@H]1C[C@H](O)/C=C/[C@H](O)[C@H](O)C(C)(C)C(=O)O1 |
| InChI | InChI=1S/C16H28O6/c1-4-5-10(17)8-12-9-11(18)6-7-13(19)14(20)16(2,3)15(21)22-12/h6-7,10-14,17-20H,4-5,8-9H2,1-3H3/b7-6+/t10-,11+,12+,13-,14-/m0/s1 |
| InChIKey | SGGHIPLOACRCAZ-UOPWFKHBSA-N |
| XLogP | 0.52 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|