C26H22N4O4S — CID 3853924
3-[[2-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-benzothiazol-2-one (PubChem CID 3853924) has the molecular formula C26H22N4O4S and a molecular weight of 486.55 g/mol. Its IUPAC name is 3-[[2-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[[2-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 3853924 |
| Molecular Formula | C26H22N4O4S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 3-[[2-[1-(2-oxochromene-3-carbonyl)piperidin-4-yl]imidazol-1-yl]methyl]-1,3-benzothiazol-2-one |
| SMILES | O=C(c1cc2ccccc2oc1=O)N1CCC(c2nccn2Cn2c(=O)sc3ccccc32)CC1 |
| InChI | InChI=1S/C26H22N4O4S/c31-24(19-15-18-5-1-3-7-21(18)34-25(19)32)28-12-9-17(10-13-28)23-27-11-14-29(23)16-30-20-6-2-4-8-22(20)35-26(30)33/h1-8,11,14-15,17H,9-10,12-13,16H2 |
| InChIKey | XXOIEVPAYUWFHW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|