C21H27N3O4S — CID 3856402
pentyl 2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 3856402) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is pentyl 2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | pentyl 2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 3856402 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | pentyl 2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCCOC(=O)CN1C(=O)CSC1c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H27N3O4S/c1-4-5-9-12-28-18(26)13-23-17(25)14-29-21(23)19-15(2)22(3)24(20(19)27)16-10-7-6-8-11-16/h6-8,10-11,21H,4-5,9,12-14H2,1-3H3 |
| InChIKey | DWDOMVUTKMNMQA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|