C17H25NO4S — CID 3792164
pentyl 2-[2-(4,5-dimethylfuran-2-yl)-4-oxo-1,3-thiazinan-3-yl]acetate (PubChem CID 3792164) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is pentyl 2-[2-(4,5-dimethylfuran-2-yl)-4-oxo-1,3-thiazinan-3-yl]acetate.
| Compound Name | pentyl 2-[2-(4,5-dimethylfuran-2-yl)-4-oxo-1,3-thiazinan-3-yl]acetate |
|---|---|
| PubChem CID | 3792164 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | pentyl 2-[2-(4,5-dimethylfuran-2-yl)-4-oxo-1,3-thiazinan-3-yl]acetate |
| SMILES | CCCCCOC(=O)CN1C(=O)CCSC1c1cc(C)c(C)o1 |
| InChI | InChI=1S/C17H25NO4S/c1-4-5-6-8-21-16(20)11-18-15(19)7-9-23-17(18)14-10-12(2)13(3)22-14/h10,17H,4-9,11H2,1-3H3 |
| InChIKey | HMINMBUHVMZDFS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|