C23H24N6O3 — CID 3862634
7-(diethylamino)-N-[2-(2-ethyltetrazol-5-yl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 3862634) has the molecular formula C23H24N6O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 7-(diethylamino)-N-[2-(2-ethyltetrazol-5-yl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | 7-(diethylamino)-N-[2-(2-ethyltetrazol-5-yl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3862634 |
| Molecular Formula | C23H24N6O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 7-(diethylamino)-N-[2-(2-ethyltetrazol-5-yl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | CCN(CC)c1ccc2cc(C(=O)Nc3ccccc3-c3nnn(CC)n3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H24N6O3/c1-4-28(5-2)16-12-11-15-13-18(23(31)32-20(15)14-16)22(30)24-19-10-8-7-9-17(19)21-25-27-29(6-3)26-21/h7-14H,4-6H2,1-3H3,(H,24,30) |
| InChIKey | RWGCLAGPDTXMPK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|