C24H28N6O4S2 — CID 3863181
N-[4-[2-[(4-methylphenyl)sulfonylamino]ethylcarbamoyl]piperidin-4-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 3863181) has the molecular formula C24H28N6O4S2 and a molecular weight of 528.66 g/mol. Its IUPAC name is N-[4-[2-[(4-methylphenyl)sulfonylamino]ethylcarbamoyl]piperidin-4-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-[2-[(4-methylphenyl)sulfonylamino]ethylcarbamoyl]piperidin-4-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3863181 |
| Molecular Formula | C24H28N6O4S2 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | N-[4-[2-[(4-methylphenyl)sulfonylamino]ethylcarbamoyl]piperidin-4-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)C2(NC(=O)c3csc(-c4cccnc4)n3)CCNCC2)cc1 |
| InChI | InChI=1S/C24H28N6O4S2/c1-17-4-6-19(7-5-17)36(33,34)28-14-13-27-23(32)24(8-11-25-12-9-24)30-21(31)20-16-35-22(29-20)18-3-2-10-26-15-18/h2-7,10,15-16,25,28H,8-9,11-14H2,1H3,(H,27,32)(H,30,31) |
| InChIKey | KWVYLCGCRZZSSU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|