C23H32N4O6S — CID 74226703
4-[(2,2-dimethyl-4-oxo-3H-pyran-6-carbonyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide (PubChem CID 74226703) has the molecular formula C23H32N4O6S and a molecular weight of 492.60 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4-oxo-3H-pyran-6-carbonyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[(2,2-dimethyl-4-oxo-3H-pyran-6-carbonyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74226703 |
| Molecular Formula | C23H32N4O6S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 4-[(2,2-dimethyl-4-oxo-3H-pyran-6-carbonyl)amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)C2(NC(=O)C3=CC(=O)CC(C)(C)O3)CCNCC2)cc1 |
| InChI | InChI=1S/C23H32N4O6S/c1-16-4-6-18(7-5-16)34(31,32)26-13-12-25-21(30)23(8-10-24-11-9-23)27-20(29)19-14-17(28)15-22(2,3)33-19/h4-7,14,24,26H,8-13,15H2,1-3H3,(H,25,30)(H,27,29) |
| InChIKey | UJFWBPJTMQYACT-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|