C24H31BrN4O5S — CID 3278996
4-[[2-(5-bromo-2-methoxyphenyl)acetyl]amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide (PubChem CID 3278996) has the molecular formula C24H31BrN4O5S and a molecular weight of 567.51 g/mol. Its IUPAC name is 4-[[2-(5-bromo-2-methoxyphenyl)acetyl]amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[[2-(5-bromo-2-methoxyphenyl)acetyl]amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3278996 |
| Molecular Formula | C24H31BrN4O5S |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | 4-[[2-(5-bromo-2-methoxyphenyl)acetyl]amino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(Br)cc1CC(=O)NC1(C(=O)NCCNS(=O)(=O)c2ccc(C)cc2)CCNCC1 |
| InChI | InChI=1S/C24H31BrN4O5S/c1-17-3-6-20(7-4-17)35(32,33)28-14-13-27-23(31)24(9-11-26-12-10-24)29-22(30)16-18-15-19(25)5-8-21(18)34-2/h3-8,15,26,28H,9-14,16H2,1-2H3,(H,27,31)(H,29,30) |
| InChIKey | HWFQGOCPVIIQQN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|