C24H32N6O6S — CID 3855983
4-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide (PubChem CID 3855983) has the molecular formula C24H32N6O6S and a molecular weight of 532.62 g/mol. Its IUPAC name is 4-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide.
| Compound Name | 4-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3855983 |
| Molecular Formula | C24H32N6O6S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 4-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoylamino]-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperidine-4-carboxamide |
| SMILES | COc1ncc(C=CC(=O)NC2(C(=O)NCCNS(=O)(=O)c3ccc(C)cc3)CCNCC2)c(OC)n1 |
| InChI | InChI=1S/C24H32N6O6S/c1-17-4-7-19(8-5-17)37(33,34)28-15-14-26-22(32)24(10-12-25-13-11-24)30-20(31)9-6-18-16-27-23(36-3)29-21(18)35-2/h4-9,16,25,28H,10-15H2,1-3H3,(H,26,32)(H,30,31) |
| InChIKey | RKMORVPNJAJPSV-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 160.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|