C20H16N2O3S — CID 38887988
naphthalen-2-yl 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 38887988) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is naphthalen-2-yl 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | naphthalen-2-yl 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 38887988 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | naphthalen-2-yl 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | O=C(CCCc1nc(-c2cccs2)no1)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H16N2O3S/c23-19(24-16-11-10-14-5-1-2-6-15(14)13-16)9-3-8-18-21-20(22-25-18)17-7-4-12-26-17/h1-2,4-7,10-13H,3,8-9H2 |
| InChIKey | MLFSFXQALMZJSU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|