C18H15N3O4S — CID 38916718
(4-cyano-2-methoxyphenyl) 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate (PubChem CID 38916718) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is (4-cyano-2-methoxyphenyl) 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate.
| Compound Name | (4-cyano-2-methoxyphenyl) 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate |
|---|---|
| PubChem CID | 38916718 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (4-cyano-2-methoxyphenyl) 4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanoate |
| SMILES | COc1cc(C#N)ccc1OC(=O)CCCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C18H15N3O4S/c1-23-14-10-12(11-19)7-8-13(14)24-17(22)6-2-5-16-20-18(21-25-16)15-4-3-9-26-15/h3-4,7-10H,2,5-6H2,1H3 |
| InChIKey | PDVPJKZSCQNZRL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|