C20H18ClN3O3S — CID 38900893
N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 38900893) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 38900893 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2ccc(Cl)cc21)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H18ClN3O3S/c21-13-7-8-16-15(10-13)24(20(26)12-27-16)11-18(25)22-9-3-6-19-23-14-4-1-2-5-17(14)28-19/h1-2,4-5,7-8,10H,3,6,9,11-12H2,(H,22,25) |
| InChIKey | WMSBGDDYIGYTPT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|