C22H20N4O2S2 — CID 38911730
N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 38911730) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 38911730 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-N-prop-2-enyl-4-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | C=CCN(C(=O)CCCc1nc(-c2cccs2)no1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C22H20N4O2S2/c1-2-13-26(22-23-17(15-30-22)16-8-4-3-5-9-16)20(27)12-6-11-19-24-21(25-28-19)18-10-7-14-29-18/h2-5,7-10,14-15H,1,6,11-13H2 |
| InChIKey | XEBFCEFDEGIIQY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|