C11H13N3OS — CID 3897079
5-methyl-3-oxo-N-phenylpyrazolidine-1-carbothioamide (PubChem CID 3897079) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-methyl-3-oxo-N-phenylpyrazolidine-1-carbothioamide.
| Compound Name | 5-methyl-3-oxo-N-phenylpyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 3897079 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-methyl-3-oxo-N-phenylpyrazolidine-1-carbothioamide |
| SMILES | CC1CC(=O)NN1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C11H13N3OS/c1-8-7-10(15)13-14(8)11(16)12-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,16)(H,13,15) |
| InChIKey | JYTTWKPIMIFKQX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|