C15H13BrO3S — CID 39051007
(E)-3-(5-bromothiophen-3-yl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 39051007) has the molecular formula C15H13BrO3S and a molecular weight of 353.24 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-3-yl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromothiophen-3-yl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 39051007 |
| Molecular Formula | C15H13BrO3S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | (E)-3-(5-bromothiophen-3-yl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2csc(Br)c2)c(OC)c1 |
| InChI | InChI=1S/C15H13BrO3S/c1-18-11-4-5-12(14(8-11)19-2)13(17)6-3-10-7-15(16)20-9-10/h3-9H,1-2H3/b6-3+ |
| InChIKey | JCMRBEDVBUFPDB-ZZXKWVIFSA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|