C13H9F3N4 — CID 39080033
6-methyl-3-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine (PubChem CID 39080033) has the molecular formula C13H9F3N4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 6-methyl-3-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine.
| Compound Name | 6-methyl-3-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
|---|---|
| PubChem CID | 39080033 |
| Molecular Formula | C13H9F3N4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 6-methyl-3-(2,3,4-trifluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
| SMILES | Cc1cc(N)c2nnc(-c3ccc(F)c(F)c3F)n2c1 |
| InChI | InChI=1S/C13H9F3N4/c1-6-4-9(17)13-19-18-12(20(13)5-6)7-2-3-8(14)11(16)10(7)15/h2-5H,17H2,1H3 |
| InChIKey | PPUDXSLOCMOZLG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|