C20H19ClN4O2S3 — CID 3913054
4-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate (PubChem CID 3913054) has the molecular formula C20H19ClN4O2S3 and a molecular weight of 479.05 g/mol. Its IUPAC name is 4-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate.
| Compound Name | 4-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate |
|---|---|
| PubChem CID | 3913054 |
| Molecular Formula | C20H19ClN4O2S3 |
| Molecular Weight | 479.05 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 4-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-ethylcarbonimidoyl]phenolate |
| SMILES | CCC(=NNC(=O)CSc1n[nH+]c(SCc2ccccc2Cl)s1)c1ccc([O-])cc1 |
| InChI | InChI=1S/C20H19ClN4O2S3/c1-2-17(13-7-9-15(26)10-8-13)22-23-18(27)12-29-20-25-24-19(30-20)28-11-14-5-3-4-6-16(14)21/h3-10,26H,2,11-12H2,1H3,(H,23,27) |
| InChIKey | OMRVDRXAXNJPQI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.05 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|