C24H22N4O2S3 — CID 6524120
4-[(Z)-C-ethyl-N-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]carbonimidoyl]phenolate (PubChem CID 6524120) has the molecular formula C24H22N4O2S3 and a molecular weight of 494.67 g/mol. Its IUPAC name is 4-[(Z)-C-ethyl-N-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]carbonimidoyl]phenolate.
| Compound Name | 4-[(Z)-C-ethyl-N-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]carbonimidoyl]phenolate |
|---|---|
| PubChem CID | 6524120 |
| Molecular Formula | C24H22N4O2S3 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 4-[(Z)-C-ethyl-N-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]carbonimidoyl]phenolate |
| SMILES | CC/C(=N/NC(=O)CSc1n[nH+]c(SCc2cccc3ccccc23)s1)c1ccc([O-])cc1 |
| InChI | InChI=1S/C24H22N4O2S3/c1-2-21(17-10-12-19(29)13-11-17)25-26-22(30)15-32-24-28-27-23(33-24)31-14-18-8-5-7-16-6-3-4-9-20(16)18/h3-13,29H,2,14-15H2,1H3,(H,26,30)/b25-21- |
| InChIKey | UQCUHKSOAROSAE-DAFNUICNSA-N |
| XLogP | 4.50 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|