C19H17ClN4O2S3 — CID 4284073
2-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate (PubChem CID 4284073) has the molecular formula C19H17ClN4O2S3 and a molecular weight of 465.03 g/mol. Its IUPAC name is 2-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate.
| Compound Name | 2-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate |
|---|---|
| PubChem CID | 4284073 |
| Molecular Formula | C19H17ClN4O2S3 |
| Molecular Weight | 465.03 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | 2-[N-[[2-[[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-4-ium-2-yl]sulfanyl]acetyl]amino]-C-methylcarbonimidoyl]phenolate |
| SMILES | CC(=NNC(=O)CSc1n[nH+]c(SCc2ccccc2Cl)s1)c1ccccc1[O-] |
| InChI | InChI=1S/C19H17ClN4O2S3/c1-12(14-7-3-5-9-16(14)25)21-22-17(26)11-28-19-24-23-18(29-19)27-10-13-6-2-4-8-15(13)20/h2-9,25H,10-11H2,1H3,(H,22,26) |
| InChIKey | RQFONNHEXPVBGF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.03 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|