C15H20N4OS — CID 39163638
6-ethyl-2-piperazin-1-yl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one (PubChem CID 39163638) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is 6-ethyl-2-piperazin-1-yl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-2-piperazin-1-yl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 39163638 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 6-ethyl-2-piperazin-1-yl-3-prop-2-enylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C=CCn1c(N2CCNCC2)nc2sc(CC)cc2c1=O |
| InChI | InChI=1S/C15H20N4OS/c1-3-7-19-14(20)12-10-11(4-2)21-13(12)17-15(19)18-8-5-16-6-9-18/h3,10,16H,1,4-9H2,2H3 |
| InChIKey | BAMJHQWDRYYDMX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|