C19H17FO4 — CID 39199735
(4-formyl-2-methoxy-6-prop-2-enylphenyl) 2-(4-fluorophenyl)acetate (PubChem CID 39199735) has the molecular formula C19H17FO4 and a molecular weight of 328.34 g/mol. Its IUPAC name is (4-formyl-2-methoxy-6-prop-2-enylphenyl) 2-(4-fluorophenyl)acetate.
| Compound Name | (4-formyl-2-methoxy-6-prop-2-enylphenyl) 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 39199735 |
| Molecular Formula | C19H17FO4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (4-formyl-2-methoxy-6-prop-2-enylphenyl) 2-(4-fluorophenyl)acetate |
| SMILES | C=CCc1cc(C=O)cc(OC)c1OC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FO4/c1-3-4-15-9-14(12-21)10-17(23-2)19(15)24-18(22)11-13-5-7-16(20)8-6-13/h3,5-10,12H,1,4,11H2,2H3 |
| InChIKey | FKWHKFPOEQEXLH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|