C19H21N3S — CID 39203310
3-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-7-thia-2,5,10-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene (PubChem CID 39203310) has the molecular formula C19H21N3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 3-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-7-thia-2,5,10-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene.
| Compound Name | 3-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-7-thia-2,5,10-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene |
|---|---|
| PubChem CID | 39203310 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-methyl-4-(5,6,7,8-tetrahydronaphthalen-2-yl)-7-thia-2,5,10-triazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene |
| SMILES | Cc1c(-c2ccc3c(c2)CCCC3)nc2sc3c(n12)CCNC3 |
| InChI | InChI=1S/C19H21N3S/c1-12-18(15-7-6-13-4-2-3-5-14(13)10-15)21-19-22(12)16-8-9-20-11-17(16)23-19/h6-7,10,20H,2-5,8-9,11H2,1H3 |
| InChIKey | YFSLMBZQLYYNPT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |