C10H19ClN2O2 — CID 39255531
2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpropanoyl chloride (PubChem CID 39255531) has the molecular formula C10H19ClN2O2 and a molecular weight of 234.73 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpropanoyl chloride.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpropanoyl chloride |
|---|---|
| PubChem CID | 39255531 |
| Molecular Formula | C10H19ClN2O2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpropanoyl chloride |
| SMILES | CC(C)(C(=O)Cl)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C10H19ClN2O2/c1-10(2,9(11)15)13-5-3-12(4-6-13)7-8-14/h14H,3-8H2,1-2H3 |
| InChIKey | LIXGWVMPIFEDSD-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|