C21H42N4O — CID 159950827
2-(4-tert-butylpiperazin-1-yl)ethanol;1-tert-butyl-4-prop-2-ynylpiperazine (PubChem CID 159950827) has the molecular formula C21H42N4O and a molecular weight of 366.59 g/mol. Its IUPAC name is 2-(4-tert-butylpiperazin-1-yl)ethanol;1-tert-butyl-4-prop-2-ynylpiperazine.
| Compound Name | 2-(4-tert-butylpiperazin-1-yl)ethanol;1-tert-butyl-4-prop-2-ynylpiperazine |
|---|---|
| PubChem CID | 159950827 |
| Molecular Formula | C21H42N4O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.34 |
| IUPAC Name | 2-(4-tert-butylpiperazin-1-yl)ethanol;1-tert-butyl-4-prop-2-ynylpiperazine |
| SMILES | C#CCN1CCN(C(C)(C)C)CC1.CC(C)(C)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C11H20N2.C10H22N2O/c1-5-6-12-7-9-13(10-8-12)11(2,3)4;1-10(2,3)12-6-4-11(5-7-12)8-9-13/h1H,6-10H2,2-4H3;13H,4-9H2,1-3H3 |
| InChIKey | OCBYPMRCUNWKGB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|