C26H22N8O5 — CID 3925579
4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(4-methoxyphenyl)-3-propan-2-ylcyclohexane-1,1,2,2-tetracarbonitrile (PubChem CID 3925579) has the molecular formula C26H22N8O5 and a molecular weight of 526.51 g/mol. Its IUPAC name is 4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(4-methoxyphenyl)-3-propan-2-ylcyclohexane-1,1,2,2-tetracarbonitrile.
| Compound Name | 4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(4-methoxyphenyl)-3-propan-2-ylcyclohexane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 3925579 |
| Molecular Formula | C26H22N8O5 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 4-[(2,4-dinitrophenyl)hydrazinylidene]-6-(4-methoxyphenyl)-3-propan-2-ylcyclohexane-1,1,2,2-tetracarbonitrile |
| SMILES | COc1ccc(C2CC(=NNc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])C(C(C)C)C(C#N)(C#N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C26H22N8O5/c1-16(2)24-22(32-31-21-9-6-18(33(35)36)10-23(21)34(37)38)11-20(17-4-7-19(39-3)8-5-17)25(12-27,13-28)26(24,14-29)15-30/h4-10,16,20,24,31H,11H2,1-3H3 |
| InChIKey | KNBWBVWRLKORGX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 215.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|