C16H22N4O5 — CID 6296738
N-[(Z)-(2-methoxy-2,6,6-trimethylcyclohexylidene)amino]-2,4-dinitroaniline (PubChem CID 6296738) has the molecular formula C16H22N4O5 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[(Z)-(2-methoxy-2,6,6-trimethylcyclohexylidene)amino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-(2-methoxy-2,6,6-trimethylcyclohexylidene)amino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 6296738 |
| Molecular Formula | C16H22N4O5 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[(Z)-(2-methoxy-2,6,6-trimethylcyclohexylidene)amino]-2,4-dinitroaniline |
| SMILES | COC1(C)CCCC(C)(C)/C1=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O5/c1-15(2)8-5-9-16(3,25-4)14(15)18-17-12-7-6-11(19(21)22)10-13(12)20(23)24/h6-7,10,17H,5,8-9H2,1-4H3/b18-14- |
| InChIKey | ZWHKKLFZWDOPTB-JXAWBTAJSA-N |
| XLogP | 3.89 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|