C22H24N2O3 — CID 3936401
N-[3-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propoxy]phenyl]acetamide (PubChem CID 3936401) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[3-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propoxy]phenyl]acetamide.
| Compound Name | N-[3-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 3936401 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-[3-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCC(=O)C=C2N(C)c3ccccc3C2(C)C)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-15(25)23-16-8-7-9-18(12-16)27-14-17(26)13-21-22(2,3)19-10-5-6-11-20(19)24(21)4/h5-13H,14H2,1-4H3,(H,23,25) |
| InChIKey | AZKLAVZPMHYNOT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|