C15H18N2O2S — CID 39395792
O-[[2-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazol-4-yl]methyl]hydroxylamine (PubChem CID 39395792) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is O-[[2-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazol-4-yl]methyl]hydroxylamine.
| Compound Name | O-[[2-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazol-4-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 39395792 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | O-[[2-(5,6,7,8-tetrahydronaphthalen-1-yloxymethyl)-1,3-thiazol-4-yl]methyl]hydroxylamine |
| SMILES | NOCc1csc(COc2cccc3c2CCCC3)n1 |
| InChI | InChI=1S/C15H18N2O2S/c16-19-8-12-10-20-15(17-12)9-18-14-7-3-5-11-4-1-2-6-13(11)14/h3,5,7,10H,1-2,4,6,8-9,16H2 |
| InChIKey | JOBBKTZAYSWGCS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|