C23H27N3O4S — CID 39517268
3-(cyclopentylsulfamoyl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide (PubChem CID 39517268) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 39517268 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-[[3-(2-oxopyrrolidin-1-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(N2CCCC2=O)c1)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C23H27N3O4S/c27-22-12-5-13-26(22)20-10-3-6-17(14-20)16-24-23(28)18-7-4-11-21(15-18)31(29,30)25-19-8-1-2-9-19/h3-4,6-7,10-11,14-15,19,25H,1-2,5,8-9,12-13,16H2,(H,24,28) |
| InChIKey | GBVMUUKDXZIBBD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |