C20H30O2S — CID 396282
(2R,4aR,7R,8aR)-4,4,7-trimethyl-2-[(1S)-1-phenylmethoxyethyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine (PubChem CID 396282) has the molecular formula C20H30O2S and a molecular weight of 334.50 g/mol. Its IUPAC name is (2R,4aR,7R,8aR)-4,4,7-trimethyl-2-[(1S)-1-phenylmethoxyethyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine.
| Compound Name | (2R,4aR,7R,8aR)-4,4,7-trimethyl-2-[(1S)-1-phenylmethoxyethyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine |
|---|---|
| PubChem CID | 396282 |
| Molecular Formula | C20H30O2S |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (2R,4aR,7R,8aR)-4,4,7-trimethyl-2-[(1S)-1-phenylmethoxyethyl]-4a,5,6,7,8,8a-hexahydrobenzo[e][1,3]oxathiine |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@H](SC2(C)C)[C@H](C)OCC3=CC=CC=C3 |
| InChI | InChI=1S/C20H30O2S/c1-14-10-11-17-18(12-14)22-19(23-20(17,3)4)15(2)21-13-16-8-6-5-7-9-16/h5-9,14-15,17-19H,10-13H2,1-4H3/t14-,15+,17-,18-,19-/m1/s1 |
| InChIKey | ULRUJYAJIOLCPB-CSFFLVESSA-N |
| XLogP | 5.20 |
| TPSA | 43.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 378 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |