C25H32ClNO2S — CID 3969954
1-[1-adamantyl(thiophen-2-ylmethyl)amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol (PubChem CID 3969954) has the molecular formula C25H32ClNO2S and a molecular weight of 446.06 g/mol. Its IUPAC name is 1-[1-adamantyl(thiophen-2-ylmethyl)amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol.
| Compound Name | 1-[1-adamantyl(thiophen-2-ylmethyl)amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 3969954 |
| Molecular Formula | C25H32ClNO2S |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-[1-adamantyl(thiophen-2-ylmethyl)amino]-3-[(2-chlorophenyl)methoxy]propan-2-ol |
| SMILES | OC(COCc1ccccc1Cl)CN(Cc1cccs1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32ClNO2S/c26-24-6-2-1-4-21(24)16-29-17-22(28)14-27(15-23-5-3-7-30-23)25-11-18-8-19(12-25)10-20(9-18)13-25/h1-7,18-20,22,28H,8-17H2 |
| InChIKey | YTCCARMXMPGYCF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |