C23H26N2OS — CID 39766171
N-(2,6-diethylphenyl)-3-(4-methylquinolin-2-yl)sulfanylpropanamide (PubChem CID 39766171) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-3-(4-methylquinolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(2,6-diethylphenyl)-3-(4-methylquinolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 39766171 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-(2,6-diethylphenyl)-3-(4-methylquinolin-2-yl)sulfanylpropanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CCSc1cc(C)c2ccccc2n1 |
| InChI | InChI=1S/C23H26N2OS/c1-4-17-9-8-10-18(5-2)23(17)25-21(26)13-14-27-22-15-16(3)19-11-6-7-12-20(19)24-22/h6-12,15H,4-5,13-14H2,1-3H3,(H,25,26) |
| InChIKey | WQSFOYYOWZYSEZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |