C23H19N5O4S2 — CID 3976790
2-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 3976790) has the molecular formula C23H19N5O4S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3976790 |
| Molecular Formula | C23H19N5O4S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 2-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccccc1-n1c(SCc2nc3sc(C)c(C)c3c(=O)[nH]2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H19N5O4S2/c1-12-13(2)34-22-20(12)21(29)25-19(26-22)11-33-23-24-15-10-14(28(30)31)8-9-16(15)27(23)17-6-4-5-7-18(17)32-3/h4-10H,11H2,1-3H3,(H,25,26,29) |
| InChIKey | JLPCVWUANJEYDU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|