C13H11F2NO2S2 — CID 39840756
5,7-difluoro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 39840756) has the molecular formula C13H11F2NO2S2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 5,7-difluoro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 5,7-difluoro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 39840756 |
| Molecular Formula | C13H11F2NO2S2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 5,7-difluoro-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(c1cccs1)N1CCCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C13H11F2NO2S2/c14-9-7-11(15)10-3-1-5-16(12(10)8-9)20(17,18)13-4-2-6-19-13/h2,4,6-8H,1,3,5H2 |
| InChIKey | YIFFBWVRONMPHF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |