C18H15ClN4O3 — CID 39849255
4-amino-6-chloro-N'-(2-methoxybenzoyl)quinoline-3-carbohydrazide (PubChem CID 39849255) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 4-amino-6-chloro-N'-(2-methoxybenzoyl)quinoline-3-carbohydrazide.
| Compound Name | 4-amino-6-chloro-N'-(2-methoxybenzoyl)quinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 39849255 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 4-amino-6-chloro-N'-(2-methoxybenzoyl)quinoline-3-carbohydrazide |
| SMILES | COc1ccccc1C(=O)NNC(=O)c1cnc2ccc(Cl)cc2c1N |
| InChI | InChI=1S/C18H15ClN4O3/c1-26-15-5-3-2-4-11(15)17(24)22-23-18(25)13-9-21-14-7-6-10(19)8-12(14)16(13)20/h2-9H,1H3,(H2,20,21)(H,22,24)(H,23,25) |
| InChIKey | UXISJWXCKOUDJX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|