C22H18F3N5O — CID 39898328
N-(2-pyridin-2-ylethyl)-5-pyrrol-1-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 39898328) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is N-(2-pyridin-2-ylethyl)-5-pyrrol-1-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | N-(2-pyridin-2-ylethyl)-5-pyrrol-1-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39898328 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-(2-pyridin-2-ylethyl)-5-pyrrol-1-yl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | O=C(NCCc1ccccn1)c1cnn(-c2cccc(C(F)(F)F)c2)c1-n1cccc1 |
| InChI | InChI=1S/C22H18F3N5O/c23-22(24,25)16-6-5-8-18(14-16)30-21(29-12-3-4-13-29)19(15-28-30)20(31)27-11-9-17-7-1-2-10-26-17/h1-8,10,12-15H,9,11H2,(H,27,31) |
| InChIKey | XVWIVAYRSSJRGS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |