C13H10Cl2FN3O2 — CID 39900703
4,5-dichloro-N'-(2-fluorobenzoyl)-1-methylpyrrole-2-carbohydrazide (PubChem CID 39900703) has the molecular formula C13H10Cl2FN3O2 and a molecular weight of 330.15 g/mol. Its IUPAC name is 4,5-dichloro-N'-(2-fluorobenzoyl)-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4,5-dichloro-N'-(2-fluorobenzoyl)-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 39900703 |
| Molecular Formula | C13H10Cl2FN3O2 |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4,5-dichloro-N'-(2-fluorobenzoyl)-1-methylpyrrole-2-carbohydrazide |
| SMILES | Cn1c(C(=O)NNC(=O)c2ccccc2F)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H10Cl2FN3O2/c1-19-10(6-8(14)11(19)15)13(21)18-17-12(20)7-4-2-3-5-9(7)16/h2-6H,1H3,(H,17,20)(H,18,21) |
| InChIKey | BMCKXSAMUUIXIH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|